C26H22ClN3O2S — CID 4564696
3-[2-(2-chlorophenyl)ethylamino]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 4564696) has the molecular formula C26H22ClN3O2S and a molecular weight of 476.00 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethylamino]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[2-(2-chlorophenyl)ethylamino]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4564696 |
| Molecular Formula | C26H22ClN3O2S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethylamino]-1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)CC(NCCc5ccccc5Cl)C4=O)cc3)sc2c1 |
| InChI | InChI=1S/C26H22ClN3O2S/c1-16-6-11-21-23(14-16)33-25(29-21)18-7-9-19(10-8-18)30-24(31)15-22(26(30)32)28-13-12-17-4-2-3-5-20(17)27/h2-11,14,22,28H,12-13,15H2,1H3 |
| InChIKey | MESOKANCUCHSKW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|