C23H18ClN3O2S — CID 108511841
N'-(5-chloro-2-methylphenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide (PubChem CID 108511841) has the molecular formula C23H18ClN3O2S and a molecular weight of 435.94 g/mol. Its IUPAC name is N'-(5-chloro-2-methylphenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide.
| Compound Name | N'-(5-chloro-2-methylphenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 108511841 |
| Molecular Formula | C23H18ClN3O2S |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N'-(5-chloro-2-methylphenyl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]oxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)C(=O)Nc4cc(Cl)ccc4C)cc3)sc2c1 |
| InChI | InChI=1S/C23H18ClN3O2S/c1-13-3-10-18-20(11-13)30-23(27-18)15-5-8-17(9-6-15)25-21(28)22(29)26-19-12-16(24)7-4-14(19)2/h3-12H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | BSZLAAPKVPROPN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|