C19H15N2O3S- — CID 7344025
(Z)-3-methyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoate (PubChem CID 7344025) has the molecular formula C19H15N2O3S- and a molecular weight of 351.41 g/mol. Its IUPAC name is (Z)-3-methyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoate.
| Compound Name | (Z)-3-methyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 7344025 |
| Molecular Formula | C19H15N2O3S- |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (Z)-3-methyl-4-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-4-oxobut-2-enoate |
| SMILES | C/C(=C/C(=O)[O-])C(=O)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C19H16N2O3S/c1-11-3-8-15-16(9-11)25-19(21-15)13-4-6-14(7-5-13)20-18(24)12(2)10-17(22)23/h3-10H,1-2H3,(H,20,24)(H,22,23)/p-1/b12-10- |
| InChIKey | UYUSYLAFLUQAIS-BENRWUELSA-M |
| XLogP | 2.91 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|