C23H26N2O3S — CID 4213659
[4-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] octanoate (PubChem CID 4213659) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is [4-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] octanoate.
| Compound Name | [4-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] octanoate |
|---|---|
| PubChem CID | 4213659 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [4-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(C(=O)Nc2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-3-4-5-6-7-8-21(26)28-18-12-10-17(11-13-18)22(27)25-23-24-19-14-9-16(2)15-20(19)29-23/h9-15H,3-8H2,1-2H3,(H,24,25,27) |
| InChIKey | QWLYSNCLYHQPDA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|