C19H15Cl2N3O2S2 — CID 18865026
3,5-dichloro-4-methoxy-N-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 18865026) has the molecular formula C19H15Cl2N3O2S2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 18865026 |
| Molecular Formula | C19H15Cl2N3O2S2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-[5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2nnc(SC/C=C/c3ccccc3)s2)cc1Cl |
| InChI | InChI=1S/C19H15Cl2N3O2S2/c1-26-16-14(20)10-13(11-15(16)21)17(25)22-18-23-24-19(28-18)27-9-5-8-12-6-3-2-4-7-12/h2-8,10-11H,9H2,1H3,(H,22,23,25)/b8-5+ |
| InChIKey | XBFHMJKDACCNAC-VMPITWQZSA-N |
| XLogP | 5.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|