C19H27N3S2 — CID 110827032
N-octyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 110827032) has the molecular formula C19H27N3S2 and a molecular weight of 361.58 g/mol. Its IUPAC name is N-octyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-octyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 110827032 |
| Molecular Formula | C19H27N3S2 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-octyl-5-[(E)-3-phenylprop-2-enyl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCCCCNc1nnc(SC/C=C/c2ccccc2)s1 |
| InChI | InChI=1S/C19H27N3S2/c1-2-3-4-5-6-10-15-20-18-21-22-19(24-18)23-16-11-14-17-12-8-7-9-13-17/h7-9,11-14H,2-6,10,15-16H2,1H3,(H,20,21)/b14-11+ |
| InChIKey | NGHDCCVALQPRFK-SDNWHVSQSA-N |
| XLogP | 6.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|