C14H8Cl4N4S3 — CID 55985310
2,5-bis[(2,6-dichloro-4-pyridinyl)methylsulfanyl]-1,3,4-thiadiazole (PubChem CID 55985310) has the molecular formula C14H8Cl4N4S3 and a molecular weight of 470.26 g/mol. Its IUPAC name is 2,5-bis[(2,6-dichloro-4-pyridinyl)methylsulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2,5-bis[(2,6-dichloro-4-pyridinyl)methylsulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 55985310 |
| Molecular Formula | C14H8Cl4N4S3 |
| Molecular Weight | 470.26 g/mol |
| Exact Mass | 467.87 |
| IUPAC Name | 2,5-bis[(2,6-dichloro-4-pyridinyl)methylsulfanyl]-1,3,4-thiadiazole |
| SMILES | Clc1cc(CSc2nnc(SCc3cc(Cl)nc(Cl)c3)s2)cc(Cl)n1 |
| InChI | InChI=1S/C14H8Cl4N4S3/c15-9-1-7(2-10(16)19-9)5-23-13-21-22-14(25-13)24-6-8-3-11(17)20-12(18)4-8/h1-4H,5-6H2 |
| InChIKey | ICILUMHWTHSDKV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.26 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|