C13H10N2S2 — CID 53306902
2-benzylsulfanyl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 53306902) has the molecular formula C13H10N2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-benzylsulfanyl-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-benzylsulfanyl-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 53306902 |
| Molecular Formula | C13H10N2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2-benzylsulfanyl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | c1ccc(CSc2nc3ncccc3s2)cc1 |
| InChI | InChI=1S/C13H10N2S2/c1-2-5-10(6-3-1)9-16-13-15-12-11(17-13)7-4-8-14-12/h1-8H,9H2 |
| InChIKey | ZLBKYOWUZICHFW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |