C14H12N2OS — CID 123160790
2-(4-ethylphenoxy)-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 123160790) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-(4-ethylphenoxy)-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 123160790 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(4-ethylphenoxy)-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | CCc1ccc(Oc2nc3ncccc3s2)cc1 |
| InChI | InChI=1S/C14H12N2OS/c1-2-10-5-7-11(8-6-10)17-14-16-13-12(18-14)4-3-9-15-13/h3-9H,2H2,1H3 |
| InChIKey | VOEDSLYAUOPBNH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |