About 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine
6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine (PubChem CID 141284113) has the molecular formula C13H7N3O2S
and a molecular weight of 269.29 g/mol. Its IUPAC name is 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine |
| PubChem CID | 141284113 |
| Molecular Formula | C13H7N3O2S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine |
| SMILES | c1cnc2nc(Oc3cnc4ccoc4c3)sc2c1 |
| InChI | InChI=1S/C13H7N3O2S/c1-2-11-12(14-4-1)16-13(19-11)18-8-6-10-9(15-7-8)3-5-17-10/h1-7H |
| InChIKey | BMRLDRCNAKSZQF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine?
The IUPAC name of 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine (CID 141284113) is 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine.
What is the SMILES notation for 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine?
The canonical SMILES for 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine is c1cnc2nc(Oc3cnc4ccoc4c3)sc2c1.
What is the InChIKey of 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine?
The InChIKey is BMRLDRCNAKSZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N3O2S/c1-2-11-12(14-4-1)16-13(19-11)18-8-6-10-9(15-7-8)3-5-17-10/h1-7H.
What are the key properties of 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine?
6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine has a molecular weight of 269.29 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-([1,3]thiazolo[4,5-b]pyridin-2-yloxy)furo[3,2-b]pyridine is sourced from PubChem (CID 141284113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).