C11H10ClNOS2 — CID 80693138
(2-benzylsulfanyl-4-chloro-1,3-thiazol-5-yl)methanol (PubChem CID 80693138) has the molecular formula C11H10ClNOS2 and a molecular weight of 271.79 g/mol. Its IUPAC name is (2-benzylsulfanyl-4-chloro-1,3-thiazol-5-yl)methanol.
| Compound Name | (2-benzylsulfanyl-4-chloro-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 80693138 |
| Molecular Formula | C11H10ClNOS2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | (2-benzylsulfanyl-4-chloro-1,3-thiazol-5-yl)methanol |
| SMILES | OCc1sc(SCc2ccccc2)nc1Cl |
| InChI | InChI=1S/C11H10ClNOS2/c12-10-9(6-14)16-11(13-10)15-7-8-4-2-1-3-5-8/h1-5,14H,6-7H2 |
| InChIKey | XPUCYKCLJFHKCO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |