C12H8ClN3S2 — CID 15143169
2-benzylsulfanyl-7-chloro-[1,3]thiazolo[5,4-d]pyrimidine (PubChem CID 15143169) has the molecular formula C12H8ClN3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is 2-benzylsulfanyl-7-chloro-[1,3]thiazolo[5,4-d]pyrimidine.
| Compound Name | 2-benzylsulfanyl-7-chloro-[1,3]thiazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 15143169 |
| Molecular Formula | C12H8ClN3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 2-benzylsulfanyl-7-chloro-[1,3]thiazolo[5,4-d]pyrimidine |
| SMILES | Clc1ncnc2sc(SCc3ccccc3)nc12 |
| InChI | InChI=1S/C12H8ClN3S2/c13-10-9-11(15-7-14-10)18-12(16-9)17-6-8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | NFWDQTBRVCGYJG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |