C13H12BrNS2 — CID 131870773
5-(bromomethyl)-2-(3-phenylprop-2-enylsulfanyl)-1,3-thiazole (PubChem CID 131870773) has the molecular formula C13H12BrNS2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(3-phenylprop-2-enylsulfanyl)-1,3-thiazole.
| Compound Name | 5-(bromomethyl)-2-(3-phenylprop-2-enylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 131870773 |
| Molecular Formula | C13H12BrNS2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 5-(bromomethyl)-2-(3-phenylprop-2-enylsulfanyl)-1,3-thiazole |
| SMILES | BrCc1cnc(SCC=Cc2ccccc2)s1 |
| InChI | InChI=1S/C13H12BrNS2/c14-9-12-10-15-13(17-12)16-8-4-7-11-5-2-1-3-6-11/h1-7,10H,8-9H2 |
| InChIKey | HXGDKYUKJJXBMG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|