About 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine
2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine (PubChem CID 160822537) has the molecular formula C17H13Br2ClN2S
and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine |
| PubChem CID | 160822537 |
| Molecular Formula | C17H13Br2ClN2S |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 469.89 |
| IUPAC Name | 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine |
| SMILES | Brc1ccc(SCc2ccccc2)nc1.Clc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H10BrNS.C5H3BrClN/c13-11-6-7-12(14-8-11)15-9-10-4-2-1-3-5-10;6-4-1-2-5(7)8-3-4/h1-8H,9H2;1-3H |
| InChIKey | SFSTYPIJEINJCQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine?
The IUPAC name of 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine (CID 160822537) is 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine.
What is the SMILES notation for 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine?
The canonical SMILES for 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine is Brc1ccc(SCc2ccccc2)nc1.Clc1ccc(Br)cn1.
What is the InChIKey of 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine?
The InChIKey is SFSTYPIJEINJCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNS.C5H3BrClN/c13-11-6-7-12(14-8-11)15-9-10-4-2-1-3-5-10;6-4-1-2-5(7)8-3-4/h1-8H,9H2;1-3H.
What are the key properties of 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine?
2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine has a molecular weight of 472.63 g/mol, XLogP of 6.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-5-bromopyridine;5-bromo-2-chloropyridine is sourced from PubChem (CID 160822537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).