About 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride
2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride (PubChem CID 162197475) has the molecular formula C17H13Br2ClN2O2S2
and a molecular weight of 536.70 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride |
| PubChem CID | 162197475 |
| Molecular Formula | C17H13Br2ClN2O2S2 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 533.85 |
| IUPAC Name | 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride |
| SMILES | Brc1ccc(SCc2ccccc2)nc1.O=S(=O)(Cl)c1ccc(Br)cn1 |
| InChI | InChI=1S/C12H10BrNS.C5H3BrClNO2S/c13-11-6-7-12(14-8-11)15-9-10-4-2-1-3-5-10;6-4-1-2-5(8-3-4)11(7,9)10/h1-8H,9H2;1-3H |
| InChIKey | ZRDHWKGUGMXGJC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride?
The IUPAC name of 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride (CID 162197475) is 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride.
What is the SMILES notation for 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride?
The canonical SMILES for 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride is Brc1ccc(SCc2ccccc2)nc1.O=S(=O)(Cl)c1ccc(Br)cn1.
What is the InChIKey of 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride?
The InChIKey is ZRDHWKGUGMXGJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNS.C5H3BrClNO2S/c13-11-6-7-12(14-8-11)15-9-10-4-2-1-3-5-10;6-4-1-2-5(8-3-4)11(7,9)10/h1-8H,9H2;1-3H.
What are the key properties of 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride?
2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride has a molecular weight of 536.70 g/mol, XLogP of 5.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-5-bromopyridine;5-bromopyridine-2-sulfonyl chloride is sourced from PubChem (CID 162197475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).