C15H13N5O5S2 — CID 2429913
6-amino-1,3-dimethyl-5-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]pyrimidine-2,4-dione (PubChem CID 2429913) has the molecular formula C15H13N5O5S2 and a molecular weight of 407.43 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2429913 |
| Molecular Formula | C15H13N5O5S2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(C(=O)CSc2nc3ccc([N+](=O)[O-])cc3s2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H13N5O5S2/c1-18-12(16)11(13(22)19(2)15(18)23)9(21)6-26-14-17-8-4-3-7(20(24)25)5-10(8)27-14/h3-5H,6,16H2,1-2H3 |
| InChIKey | SCEWCARKGYDMGW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|