C12H10N4O4S2 — CID 7854243
1-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]imidazolidin-2-one (PubChem CID 7854243) has the molecular formula C12H10N4O4S2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]imidazolidin-2-one.
| Compound Name | 1-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 7854243 |
| Molecular Formula | C12H10N4O4S2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]imidazolidin-2-one |
| SMILES | O=C(CSc1nc2ccc([N+](=O)[O-])cc2s1)N1CCNC1=O |
| InChI | InChI=1S/C12H10N4O4S2/c17-10(15-4-3-13-11(15)18)6-21-12-14-8-2-1-7(16(19)20)5-9(8)22-12/h1-2,5H,3-4,6H2,(H,13,18) |
| InChIKey | GQZFTFHTWZQINP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|