C29H28N6O8S2 — CID 126000264
tert-butyl N-[(2S)-1-[(2Z)-2-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate (PubChem CID 126000264) has the molecular formula C29H28N6O8S2 and a molecular weight of 652.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2Z)-2-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2Z)-2-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126000264 |
| Molecular Formula | C29H28N6O8S2 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2Z)-2-[[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylidene]hydrazinyl]-1-oxo-3-phenylmethoxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COCc1ccccc1)C(=O)N/N=C\c1ccc(Sc2nc3ccc([N+](=O)[O-])cc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H28N6O8S2/c1-29(2,3)43-27(37)31-22(17-42-16-18-7-5-4-6-8-18)26(36)33-30-15-19-9-12-24(23(13-19)35(40)41)44-28-32-21-11-10-20(34(38)39)14-25(21)45-28/h4-15,22H,16-17H2,1-3H3,(H,31,37)(H,33,36)/b30-15-/t22-/m0/s1 |
| InChIKey | WMGPEVCWQMCPTJ-IPVLUDNLSA-N |
| XLogP | 5.82 |
| TPSA | 188.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|