C11H11ClN4O3S — CID 78927700
4-chloro-3-methylsulfonyl-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 78927700) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is 4-chloro-3-methylsulfonyl-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 4-chloro-3-methylsulfonyl-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 78927700 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-chloro-3-methylsulfonyl-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cc1nc(NC(=O)c2ccc(Cl)c(S(C)(=O)=O)c2)n[nH]1 |
| InChI | InChI=1S/C11H11ClN4O3S/c1-6-13-11(16-15-6)14-10(17)7-3-4-8(12)9(5-7)20(2,18)19/h3-5H,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | QWJKEXNQDKDCIC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |