C12H15N5O3S — CID 78928138
4-(dimethylsulfamoyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 78928138) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 78928138 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cc1nc(NC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)n[nH]1 |
| InChI | InChI=1S/C12H15N5O3S/c1-8-13-12(16-15-8)14-11(18)9-4-6-10(7-5-9)21(19,20)17(2)3/h4-7H,1-3H3,(H2,13,14,15,16,18) |
| InChIKey | BCURQVHNXMWRIN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |