C19H16Cl2N4O3S — CID 2097930
N-(4,6-dichloro-2-phenylpyrimidin-5-yl)-4-(dimethylsulfamoyl)benzamide (PubChem CID 2097930) has the molecular formula C19H16Cl2N4O3S and a molecular weight of 451.34 g/mol. Its IUPAC name is N-(4,6-dichloro-2-phenylpyrimidin-5-yl)-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(4,6-dichloro-2-phenylpyrimidin-5-yl)-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2097930 |
| Molecular Formula | C19H16Cl2N4O3S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-(4,6-dichloro-2-phenylpyrimidin-5-yl)-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2c(Cl)nc(-c3ccccc3)nc2Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O3S/c1-25(2)29(27,28)14-10-8-13(9-11-14)19(26)22-15-16(20)23-18(24-17(15)21)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,22,26) |
| InChIKey | CLKHPSGYHCKYCJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |