C25H22ClN3O3S — CID 74763767
2-chloro-N-[3-[6-(dimethylamino)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide (PubChem CID 74763767) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-chloro-N-[3-[6-(dimethylamino)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[3-[6-(dimethylamino)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 74763767 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-chloro-N-[3-[6-(dimethylamino)quinolin-2-yl]phenyl]-4-methylsulfonylbenzamide |
| SMILES | CN(C)c1ccc2nc(-c3cccc(NC(=O)c4ccc(S(C)(=O)=O)cc4Cl)c3)ccc2c1 |
| InChI | InChI=1S/C25H22ClN3O3S/c1-29(2)19-8-12-24-17(14-19)7-11-23(28-24)16-5-4-6-18(13-16)27-25(30)21-10-9-20(15-22(21)26)33(3,31)32/h4-15H,1-3H3,(H,27,30) |
| InChIKey | GKNGTOLIYVZRMS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |