C24H25N3O3S — CID 27006276
2-methyl-6-phenyl-N-(3-piperidin-1-ylsulfonylphenyl)pyridine-3-carboxamide (PubChem CID 27006276) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-methyl-6-phenyl-N-(3-piperidin-1-ylsulfonylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-methyl-6-phenyl-N-(3-piperidin-1-ylsulfonylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 27006276 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-methyl-6-phenyl-N-(3-piperidin-1-ylsulfonylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)Nc1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-18-22(13-14-23(25-18)19-9-4-2-5-10-19)24(28)26-20-11-8-12-21(17-20)31(29,30)27-15-6-3-7-16-27/h2,4-5,8-14,17H,3,6-7,15-16H2,1H3,(H,26,28) |
| InChIKey | JJARTDWGKDFYIW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |