C30H29N3O3S — CID 70797526
4-methylsulfonyl-N-(3-pyridin-2-ylphenyl)-2-[4-(pyrrolidin-1-ylmethyl)phenyl]benzamide (PubChem CID 70797526) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is 4-methylsulfonyl-N-(3-pyridin-2-ylphenyl)-2-[4-(pyrrolidin-1-ylmethyl)phenyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-(3-pyridin-2-ylphenyl)-2-[4-(pyrrolidin-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70797526 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 4-methylsulfonyl-N-(3-pyridin-2-ylphenyl)-2-[4-(pyrrolidin-1-ylmethyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2cccc(-c3ccccn3)c2)c(-c2ccc(CN3CCCC3)cc2)c1 |
| InChI | InChI=1S/C30H29N3O3S/c1-37(35,36)26-14-15-27(28(20-26)23-12-10-22(11-13-23)21-33-17-4-5-18-33)30(34)32-25-8-6-7-24(19-25)29-9-2-3-16-31-29/h2-3,6-16,19-20H,4-5,17-18,21H2,1H3,(H,32,34) |
| InChIKey | SXQIWDZHMHFOSE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |