C27H23N3O5S — CID 70797255
4-methoxy-2-[5-methylsulfonyl-2-[(3-pyridin-2-ylphenyl)carbamoyl]phenyl]benzamide (PubChem CID 70797255) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is 4-methoxy-2-[5-methylsulfonyl-2-[(3-pyridin-2-ylphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 4-methoxy-2-[5-methylsulfonyl-2-[(3-pyridin-2-ylphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 70797255 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-methoxy-2-[5-methylsulfonyl-2-[(3-pyridin-2-ylphenyl)carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(C(N)=O)c(-c2cc(S(C)(=O)=O)ccc2C(=O)Nc2cccc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C27H23N3O5S/c1-35-19-9-11-21(26(28)31)23(15-19)24-16-20(36(2,33)34)10-12-22(24)27(32)30-18-7-5-6-17(14-18)25-8-3-4-13-29-25/h3-16H,1-2H3,(H2,28,31)(H,30,32) |
| InChIKey | CVTJESHFRGZKLB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |