C28H25N3O4S — CID 142392153
N-benzyl-6-[3-[(2-methyl-4-methylsulfonylbenzoyl)amino]phenyl]pyridine-3-carboxamide (PubChem CID 142392153) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-benzyl-6-[3-[(2-methyl-4-methylsulfonylbenzoyl)amino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-benzyl-6-[3-[(2-methyl-4-methylsulfonylbenzoyl)amino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142392153 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-benzyl-6-[3-[(2-methyl-4-methylsulfonylbenzoyl)amino]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cc(S(C)(=O)=O)ccc1C(=O)Nc1cccc(-c2ccc(C(=O)NCc3ccccc3)cn2)c1 |
| InChI | InChI=1S/C28H25N3O4S/c1-19-15-24(36(2,34)35)12-13-25(19)28(33)31-23-10-6-9-21(16-23)26-14-11-22(18-29-26)27(32)30-17-20-7-4-3-5-8-20/h3-16,18H,17H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | BWLCPVIQXJJRPL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |