C28H24N2OS — CID 123388410
2-(4-cyclopropylphenyl)-4-methylsulfanyl-N-(3-pyridin-2-ylphenyl)benzamide (PubChem CID 123388410) has the molecular formula C28H24N2OS and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-(4-cyclopropylphenyl)-4-methylsulfanyl-N-(3-pyridin-2-ylphenyl)benzamide.
| Compound Name | 2-(4-cyclopropylphenyl)-4-methylsulfanyl-N-(3-pyridin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 123388410 |
| Molecular Formula | C28H24N2OS |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-(4-cyclopropylphenyl)-4-methylsulfanyl-N-(3-pyridin-2-ylphenyl)benzamide |
| SMILES | CSc1ccc(C(=O)Nc2cccc(-c3ccccn3)c2)c(-c2ccc(C3CC3)cc2)c1 |
| InChI | InChI=1S/C28H24N2OS/c1-32-24-14-15-25(26(18-24)21-12-10-20(11-13-21)19-8-9-19)28(31)30-23-6-4-5-22(17-23)27-7-2-3-16-29-27/h2-7,10-19H,8-9H2,1H3,(H,30,31) |
| InChIKey | XUHLYJZSZBCLNP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |