C16H11ClN2OS — CID 142392244
5-chloro-N-(3-pyridin-2-ylphenyl)thiophene-2-carboxamide (PubChem CID 142392244) has the molecular formula C16H11ClN2OS and a molecular weight of 314.80 g/mol. Its IUPAC name is 5-chloro-N-(3-pyridin-2-ylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3-pyridin-2-ylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 142392244 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 5-chloro-N-(3-pyridin-2-ylphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccn2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-15-8-7-14(21-15)16(20)19-12-5-3-4-11(10-12)13-6-1-2-9-18-13/h1-10H,(H,19,20) |
| InChIKey | BCAGCKNQGZEFMK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |