C15H10ClN3O3S — CID 146131089
1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]pyrazole-3-carboxylic acid (PubChem CID 146131089) has the molecular formula C15H10ClN3O3S and a molecular weight of 347.78 g/mol. Its IUPAC name is 1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 146131089 |
| Molecular Formula | C15H10ClN3O3S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 1-[3-[(5-chlorothiophene-2-carbonyl)amino]phenyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(-c2cccc(NC(=O)c3ccc(Cl)s3)c2)n1 |
| InChI | InChI=1S/C15H10ClN3O3S/c16-13-5-4-12(23-13)14(20)17-9-2-1-3-10(8-9)19-7-6-11(18-19)15(21)22/h1-8H,(H,17,20)(H,21,22) |
| InChIKey | SGJRMDPUYONLOP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |