C25H16ClN3O3S — CID 20824129
5-chloro-N-[1,3-dioxo-2-[(3-pyridin-2-ylphenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 20824129) has the molecular formula C25H16ClN3O3S and a molecular weight of 473.94 g/mol. Its IUPAC name is 5-chloro-N-[1,3-dioxo-2-[(3-pyridin-2-ylphenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1,3-dioxo-2-[(3-pyridin-2-ylphenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20824129 |
| Molecular Formula | C25H16ClN3O3S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 5-chloro-N-[1,3-dioxo-2-[(3-pyridin-2-ylphenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)N(Cc1cccc(-c3ccccn3)c1)C2=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C25H16ClN3O3S/c26-21-11-10-20(33-21)23(30)28-19-9-4-7-17-22(19)25(32)29(24(17)31)14-15-5-3-6-16(13-15)18-8-1-2-12-27-18/h1-13H,14H2,(H,28,30) |
| InChIKey | DRXCKLXWAWRUQE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|