C19H13ClIN3O2S — CID 58137705
5-chloro-N-[6-[(3-iodophenyl)methyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-4-yl]thiophene-2-carboxamide (PubChem CID 58137705) has the molecular formula C19H13ClIN3O2S and a molecular weight of 509.76 g/mol. Its IUPAC name is 5-chloro-N-[6-[(3-iodophenyl)methyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[6-[(3-iodophenyl)methyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58137705 |
| Molecular Formula | C19H13ClIN3O2S |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 508.95 |
| IUPAC Name | 5-chloro-N-[6-[(3-iodophenyl)methyl]-5-oxo-7H-pyrrolo[3,4-b]pyridin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccnc2c1C(=O)N(Cc1cccc(I)c1)C2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H13ClIN3O2S/c20-16-5-4-15(27-16)18(25)23-13-6-7-22-14-10-24(19(26)17(13)14)9-11-2-1-3-12(21)8-11/h1-8H,9-10H2,(H,22,23,25) |
| InChIKey | URFGRAZEHKUQIF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|