C21H15ClN2O3S — CID 22337089
5-chloro-N-[2-[(3-formylphenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 22337089) has the molecular formula C21H15ClN2O3S and a molecular weight of 410.88 g/mol. Its IUPAC name is 5-chloro-N-[2-[(3-formylphenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[(3-formylphenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22337089 |
| Molecular Formula | C21H15ClN2O3S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 5-chloro-N-[2-[(3-formylphenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | O=Cc1cccc(CN2Cc3c(NC(=O)c4ccc(Cl)s4)cccc3C2=O)c1 |
| InChI | InChI=1S/C21H15ClN2O3S/c22-19-8-7-18(28-19)20(26)23-17-6-2-5-15-16(17)11-24(21(15)27)10-13-3-1-4-14(9-13)12-25/h1-9,12H,10-11H2,(H,23,26) |
| InChIKey | AILCWXYTFJEGHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|