C21H16ClIN2O3S — CID 24810979
5-chloro-N-[2-[(3-iodo-4-methoxyphenyl)methyl]-3-oxo-1H-isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 24810979) has the molecular formula C21H16ClIN2O3S and a molecular weight of 538.79 g/mol. Its IUPAC name is 5-chloro-N-[2-[(3-iodo-4-methoxyphenyl)methyl]-3-oxo-1H-isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[2-[(3-iodo-4-methoxyphenyl)methyl]-3-oxo-1H-isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24810979 |
| Molecular Formula | C21H16ClIN2O3S |
| Molecular Weight | 538.79 g/mol |
| Exact Mass | 537.96 |
| IUPAC Name | 5-chloro-N-[2-[(3-iodo-4-methoxyphenyl)methyl]-3-oxo-1H-isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CN2Cc3cccc(NC(=O)c4ccc(Cl)s4)c3C2=O)cc1I |
| InChI | InChI=1S/C21H16ClIN2O3S/c1-28-16-6-5-12(9-14(16)23)10-25-11-13-3-2-4-15(19(13)21(25)27)24-20(26)17-7-8-18(22)29-17/h2-9H,10-11H2,1H3,(H,24,26) |
| InChIKey | QSBFHJUTZMGUTD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.79 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|