C25H23ClN4O3S — CID 20824139
5-chloro-N-[1,3-dioxo-2-[[3-[(pyrrolidin-1-ylamino)methyl]phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 20824139) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is 5-chloro-N-[1,3-dioxo-2-[[3-[(pyrrolidin-1-ylamino)methyl]phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1,3-dioxo-2-[[3-[(pyrrolidin-1-ylamino)methyl]phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20824139 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 5-chloro-N-[1,3-dioxo-2-[[3-[(pyrrolidin-1-ylamino)methyl]phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)N(Cc1cccc(CNN3CCCC3)c1)C2=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C25H23ClN4O3S/c26-21-10-9-20(34-21)23(31)28-19-8-4-7-18-22(19)25(33)30(24(18)32)15-17-6-3-5-16(13-17)14-27-29-11-1-2-12-29/h3-10,13,27H,1-2,11-12,14-15H2,(H,28,31) |
| InChIKey | GNGVZCDPNRDUKG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|