C26H17ClN6O4S — CID 20824137
5-chloro-N-[1,3-dioxo-2-[[3-(7H-purin-8-ylmethoxy)phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 20824137) has the molecular formula C26H17ClN6O4S and a molecular weight of 544.98 g/mol. Its IUPAC name is 5-chloro-N-[1,3-dioxo-2-[[3-(7H-purin-8-ylmethoxy)phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1,3-dioxo-2-[[3-(7H-purin-8-ylmethoxy)phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20824137 |
| Molecular Formula | C26H17ClN6O4S |
| Molecular Weight | 544.98 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 5-chloro-N-[1,3-dioxo-2-[[3-(7H-purin-8-ylmethoxy)phenyl]methyl]isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)N(Cc1cccc(OCc3nc4ncncc4[nH]3)c1)C2=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H17ClN6O4S/c27-20-8-7-19(38-20)24(34)31-17-6-2-5-16-22(17)26(36)33(25(16)35)11-14-3-1-4-15(9-14)37-12-21-30-18-10-28-13-29-23(18)32-21/h1-10,13H,11-12H2,(H,31,34)(H,28,29,30,32) |
| InChIKey | QQDIXSWHWRJVAB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|