C19H16ClF3N4O5S — CID 162088898
N-[2-(4-amino-4-iminobutyl)-1,3-dioxoisoindol-4-yl]-5-chlorothiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 162088898) has the molecular formula C19H16ClF3N4O5S and a molecular weight of 504.87 g/mol. Its IUPAC name is N-[2-(4-amino-4-iminobutyl)-1,3-dioxoisoindol-4-yl]-5-chlorothiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(4-amino-4-iminobutyl)-1,3-dioxoisoindol-4-yl]-5-chlorothiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162088898 |
| Molecular Formula | C19H16ClF3N4O5S |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | N-[2-(4-amino-4-iminobutyl)-1,3-dioxoisoindol-4-yl]-5-chlorothiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)CCCN1C(=O)c2cccc(NC(=O)c3ccc(Cl)s3)c2C1=O |
| InChI | InChI=1S/C17H15ClN4O3S.C2HF3O2/c18-12-7-6-11(26-12)15(23)21-10-4-1-3-9-14(10)17(25)22(16(9)24)8-2-5-13(19)20;3-2(4,5)1(6)7/h1,3-4,6-7H,2,5,8H2,(H3,19,20)(H,21,23);(H,6,7) |
| InChIKey | SZVVMKJWAVHBRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|