C13H16ClN3O2 — CID 21298870
5-(1,3-dioxoisoindol-2-yl)pentanimidamide;hydrochloride (PubChem CID 21298870) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)pentanimidamide;hydrochloride.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)pentanimidamide;hydrochloride |
|---|---|
| PubChem CID | 21298870 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)pentanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H15N3O2.ClH/c14-11(15)7-3-4-8-16-12(17)9-5-1-2-6-10(9)13(16)18;/h1-2,5-6H,3-4,7-8H2,(H3,14,15);1H |
| InChIKey | SOOWZHNKSJXYOY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|