C20H14ClIN2O3S — CID 91427146
5-chloro-N-[1,3-dihydroxy-2-[(3-iodophenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 91427146) has the molecular formula C20H14ClIN2O3S and a molecular weight of 524.77 g/mol. Its IUPAC name is 5-chloro-N-[1,3-dihydroxy-2-[(3-iodophenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1,3-dihydroxy-2-[(3-iodophenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91427146 |
| Molecular Formula | C20H14ClIN2O3S |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | 5-chloro-N-[1,3-dihydroxy-2-[(3-iodophenyl)methyl]isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2c(O)n(Cc3cccc(I)c3)c(O)c12)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H14ClIN2O3S/c21-16-8-7-15(28-16)18(25)23-14-6-2-5-13-17(14)20(27)24(19(13)26)10-11-3-1-4-12(22)9-11/h1-9,26-27H,10H2,(H,23,25) |
| InChIKey | UUTVSZZQQMPGED-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|