C20H14ClIN2O3S — CID 24810977
5-chloro-N-[3-hydroxy-2-[(4-iodophenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 24810977) has the molecular formula C20H14ClIN2O3S and a molecular weight of 524.77 g/mol. Its IUPAC name is 5-chloro-N-[3-hydroxy-2-[(4-iodophenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[3-hydroxy-2-[(4-iodophenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24810977 |
| Molecular Formula | C20H14ClIN2O3S |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | 5-chloro-N-[3-hydroxy-2-[(4-iodophenyl)methyl]-1-oxo-3H-isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(O)N(Cc1ccc(I)cc1)C2=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H14ClIN2O3S/c21-16-9-8-15(28-16)18(25)23-14-3-1-2-13-17(14)20(27)24(19(13)26)10-11-4-6-12(22)7-5-11/h1-9,20,27H,10H2,(H,23,25) |
| InChIKey | ICMUWUCZYOPKLN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|