C24H20Cl2N2O3 — CID 2953562
N-(3-benzoyl-4-morpholin-4-ylphenyl)-2,4-dichlorobenzamide (PubChem CID 2953562) has the molecular formula C24H20Cl2N2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is N-(3-benzoyl-4-morpholin-4-ylphenyl)-2,4-dichlorobenzamide.
| Compound Name | N-(3-benzoyl-4-morpholin-4-ylphenyl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2953562 |
| Molecular Formula | C24H20Cl2N2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(3-benzoyl-4-morpholin-4-ylphenyl)-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(C(=O)c2ccccc2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20Cl2N2O3/c25-17-6-8-19(21(26)14-17)24(30)27-18-7-9-22(28-10-12-31-13-11-28)20(15-18)23(29)16-4-2-1-3-5-16/h1-9,14-15H,10-13H2,(H,27,30) |
| InChIKey | JGUKWCSUPPYLCM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|