C19H16ClF6NO4S — CID 122622702
N-[3-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 122622702) has the molecular formula C19H16ClF6NO4S and a molecular weight of 503.85 g/mol. Its IUPAC name is N-[3-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[3-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 122622702 |
| Molecular Formula | C19H16ClF6NO4S |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | N-[3-chloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H16ClF6NO4S/c1-2-32(30,31)13-6-3-11(4-7-13)9-16(28)27-12-5-8-14(15(20)10-12)17(29,18(21,22)23)19(24,25)26/h3-8,10,29H,2,9H2,1H3,(H,27,28) |
| InChIKey | YYVCZGCJMCFAII-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |