C18H16F6N2O4S — CID 118144406
2-(4-ethylsulfonylphenyl)-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide (PubChem CID 118144406) has the molecular formula C18H16F6N2O4S and a molecular weight of 470.39 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 118144406 |
| Molecular Formula | C18H16F6N2O4S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-pyridinyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C18H16F6N2O4S/c1-2-31(29,30)13-6-3-11(4-7-13)9-15(27)26-14-8-5-12(10-25-14)16(28,17(19,20)21)18(22,23)24/h3-8,10,28H,2,9H2,1H3,(H,25,26,27) |
| InChIKey | CTLRXSJROLORBW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |