C24H25F6NO4S — CID 118395824
N-[4-[2-(cyclobutylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 118395824) has the molecular formula C24H25F6NO4S and a molecular weight of 537.52 g/mol. Its IUPAC name is N-[4-[2-(cyclobutylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[4-[2-(cyclobutylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 118395824 |
| Molecular Formula | C24H25F6NO4S |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-[4-[2-(cyclobutylmethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(OCC3CCC3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H25F6NO4S/c1-2-36(33,34)20-12-6-16(7-13-20)14-21(32)31-19-10-8-18(9-11-19)22(23(25,26)27,24(28,29)30)35-15-17-4-3-5-17/h6-13,17H,2-5,14-15H2,1H3,(H,31,32) |
| InChIKey | WOKPGOPYSFBOHZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |