C26H30F6N2O4S — CID 118395930
2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]acetamide (PubChem CID 118395930) has the molecular formula C26H30F6N2O4S and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 118395930 |
| Molecular Formula | C26H30F6N2O4S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2-piperidin-1-ylethoxy)propan-2-yl]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(OCCN3CCCCC3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H30F6N2O4S/c1-2-39(36,37)22-12-6-19(7-13-22)18-23(35)33-21-10-8-20(9-11-21)24(25(27,28)29,26(30,31)32)38-17-16-34-14-4-3-5-15-34/h6-13H,2-5,14-18H2,1H3,(H,33,35) |
| InChIKey | JFFZBLLBODZVLQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |