C22H21F6NO5S — CID 122622762
2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide (PubChem CID 122622762) has the molecular formula C22H21F6NO5S and a molecular weight of 525.47 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 122622762 |
| Molecular Formula | C22H21F6NO5S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-[4-(cyclopropylmethylsulfonyl)phenyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide |
| SMILES | COc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)Cc1ccc(S(=O)(=O)CC2CC2)cc1 |
| InChI | InChI=1S/C22H21F6NO5S/c1-34-18-11-15(20(31,21(23,24)25)22(26,27)28)6-9-17(18)29-19(30)10-13-4-7-16(8-5-13)35(32,33)12-14-2-3-14/h4-9,11,14,31H,2-3,10,12H2,1H3,(H,29,30) |
| InChIKey | ZKCAANXVNVTZRX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |