C21H19F7N2O5S — CID 122622703
2-[4-(cyclopropylsulfamoyl)phenyl]-N-[5-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide (PubChem CID 122622703) has the molecular formula C21H19F7N2O5S and a molecular weight of 544.45 g/mol. Its IUPAC name is 2-[4-(cyclopropylsulfamoyl)phenyl]-N-[5-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-[4-(cyclopropylsulfamoyl)phenyl]-N-[5-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 122622703 |
| Molecular Formula | C21H19F7N2O5S |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 2-[4-(cyclopropylsulfamoyl)phenyl]-N-[5-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methoxyphenyl]acetamide |
| SMILES | COc1cc(C(O)(C(F)(F)F)C(F)(F)F)c(F)cc1NC(=O)Cc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C21H19F7N2O5S/c1-35-17-9-14(19(32,20(23,24)25)21(26,27)28)15(22)10-16(17)29-18(31)8-11-2-6-13(7-3-11)36(33,34)30-12-4-5-12/h2-3,6-7,9-10,12,30,32H,4-5,8H2,1H3,(H,29,31) |
| InChIKey | MHGXTNCXESGYQL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |