C20H17F7N2O4S — CID 122622646
2-[3-(cyclopropylsulfamoyl)phenyl]-N-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide (PubChem CID 122622646) has the molecular formula C20H17F7N2O4S and a molecular weight of 514.42 g/mol. Its IUPAC name is 2-[3-(cyclopropylsulfamoyl)phenyl]-N-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide.
| Compound Name | 2-[3-(cyclopropylsulfamoyl)phenyl]-N-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 122622646 |
| Molecular Formula | C20H17F7N2O4S |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 2-[3-(cyclopropylsulfamoyl)phenyl]-N-[3-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(S(=O)(=O)NC2CC2)c1)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C20H17F7N2O4S/c21-16-10-13(6-7-15(16)18(31,19(22,23)24)20(25,26)27)28-17(30)9-11-2-1-3-14(8-11)34(32,33)29-12-4-5-12/h1-3,6-8,10,12,29,31H,4-5,9H2,(H,28,30) |
| InChIKey | ZSBBFPKAMFKGGV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |