C20H22FNO2S — CID 145232045
2-(4-ethylsulfanylphenyl)-N-[3-fluoro-4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide (PubChem CID 145232045) has the molecular formula C20H22FNO2S and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-N-[3-fluoro-4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfanylphenyl)-N-[3-fluoro-4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 145232045 |
| Molecular Formula | C20H22FNO2S |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-N-[3-fluoro-4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(C(C)(C)C=O)c(F)c2)cc1 |
| InChI | InChI=1S/C20H22FNO2S/c1-4-25-16-8-5-14(6-9-16)11-19(24)22-15-7-10-17(18(21)12-15)20(2,3)13-23/h5-10,12-13H,4,11H2,1-3H3,(H,22,24) |
| InChIKey | SOAMRUWRNPFZMY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|