C24H32N2O3S — CID 145232207
tert-butyl N-[2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]propan-2-yl]carbamate (PubChem CID 145232207) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 145232207 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl N-[2-[4-[[2-(4-ethylsulfanylphenyl)acetyl]amino]phenyl]propan-2-yl]carbamate |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(C(C)(C)NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O3S/c1-7-30-20-14-8-17(9-15-20)16-21(27)25-19-12-10-18(11-13-19)24(5,6)26-22(28)29-23(2,3)4/h8-15H,7,16H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | WYBMHVHVIIQBPG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |