C27H31ClF3N3O2S — CID 145232126
chloromethane;2-(5-ethylsulfanyl-2-pyridinyl)-N-[4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide;2,4,5-trifluoro-N-methylaniline (PubChem CID 145232126) has the molecular formula C27H31ClF3N3O2S and a molecular weight of 554.08 g/mol. Its IUPAC name is chloromethane;2-(5-ethylsulfanyl-2-pyridinyl)-N-[4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide;2,4,5-trifluoro-N-methylaniline.
| Compound Name | chloromethane;2-(5-ethylsulfanyl-2-pyridinyl)-N-[4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide;2,4,5-trifluoro-N-methylaniline |
|---|---|
| PubChem CID | 145232126 |
| Molecular Formula | C27H31ClF3N3O2S |
| Molecular Weight | 554.08 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | chloromethane;2-(5-ethylsulfanyl-2-pyridinyl)-N-[4-(2-methyl-1-oxopropan-2-yl)phenyl]acetamide;2,4,5-trifluoro-N-methylaniline |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(C(C)(C)C=O)cc2)nc1.CCl.CNc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H22N2O2S.C7H6F3N.CH3Cl/c1-4-24-17-10-9-16(20-12-17)11-18(23)21-15-7-5-14(6-8-15)19(2,3)13-22;1-11-7-3-5(9)4(8)2-6(7)10;1-2/h5-10,12-13H,4,11H2,1-3H3,(H,21,23);2-3,11H,1H3;1H3 |
| InChIKey | GIEOTWRKRAPRDP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.08 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|